Organic acids and derivatives
Filtered Search Results
Isovaleramide, 98%
CAS: 541-46-8 Molecular Formula: C5H11NO Molecular Weight (g/mol): 101.149 MDL Number: MFCD00014807 InChI Key: SANOUVWGPVYVAV-UHFFFAOYSA-N Synonym: isovaleramide,butanamide, 3-methyl,3-methylbutyramide,isovaleric amide,isopentanamide,beta-methylbutyramide,isovaleric acid amide,unii-9cp4kb634m,isovaleramide usan,.beta.-methylbutyramide PubChem CID: 10930 IUPAC Name: 3-methylbutanamide SMILES: CC(C)CC(=O)N
| PubChem CID | 10930 |
|---|---|
| CAS | 541-46-8 |
| Molecular Weight (g/mol) | 101.149 |
| MDL Number | MFCD00014807 |
| SMILES | CC(C)CC(=O)N |
| Synonym | isovaleramide,butanamide, 3-methyl,3-methylbutyramide,isovaleric amide,isopentanamide,beta-methylbutyramide,isovaleric acid amide,unii-9cp4kb634m,isovaleramide usan,.beta.-methylbutyramide |
| IUPAC Name | 3-methylbutanamide |
| InChI Key | SANOUVWGPVYVAV-UHFFFAOYSA-N |
| Molecular Formula | C5H11NO |
2-Methoxyethyl acrylate, 98%, stab. with ca 50-100ppm 4-methoxyphenol
CAS: 3121-61-7 Molecular Formula: C6H10O3 Molecular Weight (g/mol): 130.14 MDL Number: MFCD00048149,MFCD00803685 InChI Key: HFCUBKYHMMPGBY-UHFFFAOYSA-N Synonym: 2-methoxyethyl acrylate,methoxyethyl acrylate,2-methoxyethoxy acrylate,2-propenoic acid, 2-methoxyethyl ester,methyl cellosolve acrylate,2-methoxyethanol, acrylate,ethylene glycol monomethyl ether acrylate,acrylic acid, 2-methoxyethyl ester,ethylene glycol methyl ether acrylate,sipomer mca PubChem CID: 18392 IUPAC Name: 2-methoxyethyl prop-2-enoate SMILES: COCCOC(=O)C=C
| PubChem CID | 18392 |
|---|---|
| CAS | 3121-61-7 |
| Molecular Weight (g/mol) | 130.14 |
| MDL Number | MFCD00048149,MFCD00803685 |
| SMILES | COCCOC(=O)C=C |
| Synonym | 2-methoxyethyl acrylate,methoxyethyl acrylate,2-methoxyethoxy acrylate,2-propenoic acid, 2-methoxyethyl ester,methyl cellosolve acrylate,2-methoxyethanol, acrylate,ethylene glycol monomethyl ether acrylate,acrylic acid, 2-methoxyethyl ester,ethylene glycol methyl ether acrylate,sipomer mca |
| IUPAC Name | 2-methoxyethyl prop-2-enoate |
| InChI Key | HFCUBKYHMMPGBY-UHFFFAOYSA-N |
| Molecular Formula | C6H10O3 |
N,N-Di-n-butylformamide, 99%
CAS: 761-65-9 Molecular Formula: C9H19NO Molecular Weight (g/mol): 157.26 MDL Number: MFCD00003289 InChI Key: NZMAJUHVSZBJHL-UHFFFAOYSA-N Synonym: dibutylformamide,formamide, n,n-dibutyl,n,n-di-n-butylformamide,formamide, n,n-di-n-butyl,dibutylamid kyseliny mravenci,dibutylamid kyseliny mravenci czech,formamide, dibutyl,n-formyldibutylamine,formamide,n-dibutyl,n,n-di-butylformamide PubChem CID: 12975 IUPAC Name: N,N-dibutylformamide SMILES: CCCCN(CCCC)C=O
| PubChem CID | 12975 |
|---|---|
| CAS | 761-65-9 |
| Molecular Weight (g/mol) | 157.26 |
| MDL Number | MFCD00003289 |
| SMILES | CCCCN(CCCC)C=O |
| Synonym | dibutylformamide,formamide, n,n-dibutyl,n,n-di-n-butylformamide,formamide, n,n-di-n-butyl,dibutylamid kyseliny mravenci,dibutylamid kyseliny mravenci czech,formamide, dibutyl,n-formyldibutylamine,formamide,n-dibutyl,n,n-di-butylformamide |
| IUPAC Name | N,N-dibutylformamide |
| InChI Key | NZMAJUHVSZBJHL-UHFFFAOYSA-N |
| Molecular Formula | C9H19NO |
4-Methylbenzeneboronic acid neopentyl glycol ester, 99%
CAS: 380481-66-3 Molecular Formula: C12H17BO2 Molecular Weight (g/mol): 204.076 MDL Number: MFCD03788728 InChI Key: ZSPBWRPQSPRISS-UHFFFAOYSA-N Synonym: 5,5-dimethyl-2-p-tolyl-1,3,2-dioxaborinane,4-methylbenzeneboronic acid neopentyl glycol ester,5,5-dimethyl-2-4-methylphenyl-1,3,2-dioxaborinane,amtb973,2-p-tolyl-5,5-dimethyl-1,3,2-dioxaborinane,5,5-dimethyl-2-p-tolyl-1,3,2-dioxaborine,2-4-methylphenyl-5,5-dimethyl-1,3,2-dioxaborinane PubChem CID: 23005406 IUPAC Name: 5,5-dimethyl-2-(4-methylphenyl)-1,3,2-dioxaborinane SMILES: B1(OCC(CO1)(C)C)C2=CC=C(C=C2)C
| PubChem CID | 23005406 |
|---|---|
| CAS | 380481-66-3 |
| Molecular Weight (g/mol) | 204.076 |
| MDL Number | MFCD03788728 |
| SMILES | B1(OCC(CO1)(C)C)C2=CC=C(C=C2)C |
| Synonym | 5,5-dimethyl-2-p-tolyl-1,3,2-dioxaborinane,4-methylbenzeneboronic acid neopentyl glycol ester,5,5-dimethyl-2-4-methylphenyl-1,3,2-dioxaborinane,amtb973,2-p-tolyl-5,5-dimethyl-1,3,2-dioxaborinane,5,5-dimethyl-2-p-tolyl-1,3,2-dioxaborine,2-4-methylphenyl-5,5-dimethyl-1,3,2-dioxaborinane |
| IUPAC Name | 5,5-dimethyl-2-(4-methylphenyl)-1,3,2-dioxaborinane |
| InChI Key | ZSPBWRPQSPRISS-UHFFFAOYSA-N |
| Molecular Formula | C12H17BO2 |
Methacrylamide, 98%
CAS: 79-39-0 Molecular Formula: C4H7NO Molecular Weight (g/mol): 85.106 MDL Number: MFCD00008018 InChI Key: FQPSGWSUVKBHSU-UHFFFAOYSA-N Synonym: methacrylamide,2-methylacrylamide,methacrylic amide,methacrylic acid amide,2-propenamide, 2-methyl,2-methylpropenamide,methacryamide,methylacrylic amide,mhoromer bm801,alpha-methyl acrylic amide PubChem CID: 6595 ChEBI: CHEBI:51759 IUPAC Name: 2-methylprop-2-enamide SMILES: CC(=C)C(=O)N
| PubChem CID | 6595 |
|---|---|
| CAS | 79-39-0 |
| Molecular Weight (g/mol) | 85.106 |
| ChEBI | CHEBI:51759 |
| MDL Number | MFCD00008018 |
| SMILES | CC(=C)C(=O)N |
| Synonym | methacrylamide,2-methylacrylamide,methacrylic amide,methacrylic acid amide,2-propenamide, 2-methyl,2-methylpropenamide,methacryamide,methylacrylic amide,mhoromer bm801,alpha-methyl acrylic amide |
| IUPAC Name | 2-methylprop-2-enamide |
| InChI Key | FQPSGWSUVKBHSU-UHFFFAOYSA-N |
| Molecular Formula | C4H7NO |
N-(5-Bromopentyl)phthalimide, 97%
CAS: 954-81-4 Molecular Formula: C13H14BrNO2 Molecular Weight (g/mol): 296.164 MDL Number: MFCD00060522 InChI Key: QKVHAKICMNABGB-UHFFFAOYSA-N Synonym: n-5-bromopentyl phthalimide,2-5-bromopentyl isoindole-1,3-dione,n-5-bromopentyl-phthalimide,2-5-bromopentyl isoindoline-1,3-dione,2-5-bromo-pentyl-isoindole-1,3-dione,2-5-bromopentyl-1h-isoindole-1,3 2h-dione,2-5-bromopentyl-2,3-dihydro-1h-isoindole-1,3-dione,5-phthalimidopentyl bromide,1-bromo-5-phthalimidopentane PubChem CID: 136770 IUPAC Name: 2-(5-bromopentyl)isoindole-1,3-dione SMILES: C1=CC=C2C(=C1)C(=O)N(C2=O)CCCCCBr
| PubChem CID | 136770 |
|---|---|
| CAS | 954-81-4 |
| Molecular Weight (g/mol) | 296.164 |
| MDL Number | MFCD00060522 |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCCCCBr |
| Synonym | n-5-bromopentyl phthalimide,2-5-bromopentyl isoindole-1,3-dione,n-5-bromopentyl-phthalimide,2-5-bromopentyl isoindoline-1,3-dione,2-5-bromo-pentyl-isoindole-1,3-dione,2-5-bromopentyl-1h-isoindole-1,3 2h-dione,2-5-bromopentyl-2,3-dihydro-1h-isoindole-1,3-dione,5-phthalimidopentyl bromide,1-bromo-5-phthalimidopentane |
| IUPAC Name | 2-(5-bromopentyl)isoindole-1,3-dione |
| InChI Key | QKVHAKICMNABGB-UHFFFAOYSA-N |
| Molecular Formula | C13H14BrNO2 |
Dihydrofluorescein diacetate, 97%
CAS: 35340-49-9 Molecular Formula: C24H18O7 Molecular Weight (g/mol): 418.401 MDL Number: MFCD00005056 InChI Key: YKSJJXGQHSESKB-UHFFFAOYSA-N Synonym: dihydrofluorescein diacetate,2-3,6-diacetoxy-9h-xanthen-9-yl benzoic acid,diacetyldihydrofluorescein,2-3,6-diacetoxy-9h-xanth-9-yl benzoic acid,2-3,6-bis acetyloxy-9h-xanthen-9-yl benzoic acid,dihydrofluorescein diacetate h2fda,2-3,6-diacetyloxy-9h-xanthen-9-yl benzoic acid,2-3,6-bis acetyloxy-9h-xanthen-9-yl benzoic acid # PubChem CID: 629056 IUPAC Name: 2-(3,6-diacetyloxy-9H-xanthen-9-yl)benzoic acid SMILES: CC(=O)OC1=CC2=C(C=C1)C(C3=C(O2)C=C(C=C3)OC(=O)C)C4=CC=CC=C4C(=O)O
| PubChem CID | 629056 |
|---|---|
| CAS | 35340-49-9 |
| Molecular Weight (g/mol) | 418.401 |
| MDL Number | MFCD00005056 |
| SMILES | CC(=O)OC1=CC2=C(C=C1)C(C3=C(O2)C=C(C=C3)OC(=O)C)C4=CC=CC=C4C(=O)O |
| Synonym | dihydrofluorescein diacetate,2-3,6-diacetoxy-9h-xanthen-9-yl benzoic acid,diacetyldihydrofluorescein,2-3,6-diacetoxy-9h-xanth-9-yl benzoic acid,2-3,6-bis acetyloxy-9h-xanthen-9-yl benzoic acid,dihydrofluorescein diacetate h2fda,2-3,6-diacetyloxy-9h-xanthen-9-yl benzoic acid,2-3,6-bis acetyloxy-9h-xanthen-9-yl benzoic acid # |
| IUPAC Name | 2-(3,6-diacetyloxy-9H-xanthen-9-yl)benzoic acid |
| InChI Key | YKSJJXGQHSESKB-UHFFFAOYSA-N |
| Molecular Formula | C24H18O7 |
Thioglycolic acid, 99.94%, Bacteriological grade, MP Biomedicals™
CAS: 367-51-1 Molecular Formula: C2H3NaO2S Molecular Weight (g/mol): 114.094 InChI Key: GNBVPFITFYNRCN-UHFFFAOYSA-M Synonym: sodium thioglycolate,sodium mercaptoacetate,mercaptoacetic acid sodium salt,mollescal sf,sodium 2-sulfanylacetate,thioglycolate sodium,sodium thioglycollate,mercaptoacetic acid, sodium salt,erhavit d,sodium 2-mercatoethanoate PubChem CID: 23690444 ChEBI: CHEBI:86481 IUPAC Name: sodium;2-sulfanylacetate SMILES: C(C(=O)[O-])S.[Na+]
| PubChem CID | 23690444 |
|---|---|
| CAS | 367-51-1 |
| Molecular Weight (g/mol) | 114.094 |
| ChEBI | CHEBI:86481 |
| SMILES | C(C(=O)[O-])S.[Na+] |
| Synonym | sodium thioglycolate,sodium mercaptoacetate,mercaptoacetic acid sodium salt,mollescal sf,sodium 2-sulfanylacetate,thioglycolate sodium,sodium thioglycollate,mercaptoacetic acid, sodium salt,erhavit d,sodium 2-mercatoethanoate |
| IUPAC Name | sodium;2-sulfanylacetate |
| InChI Key | GNBVPFITFYNRCN-UHFFFAOYSA-M |
| Molecular Formula | C2H3NaO2S |
Mercaptosuccinic acid, 98%
CAS: 70-49-5 Molecular Formula: C4H6O4S Molecular Weight (g/mol): 150.148 MDL Number: MFCD00004860 InChI Key: NJRXVEJTAYWCQJ-UHFFFAOYSA-N Synonym: mercaptosuccinic acid,thiomalic acid,2-thiomalic acid,2-mercaptosuccinic acid,monomercaptosuccinic acid,butanedioic acid, mercapto,malic acid, 2-thio,mercaptosuccinate,2-sulfanylsuccinic acid,dl-mercaptosuccinic acid PubChem CID: 6268 ChEBI: CHEBI:38705 IUPAC Name: 2-sulfanylbutanedioic acid SMILES: C(C(C(=O)O)S)C(=O)O
| PubChem CID | 6268 |
|---|---|
| CAS | 70-49-5 |
| Molecular Weight (g/mol) | 150.148 |
| ChEBI | CHEBI:38705 |
| MDL Number | MFCD00004860 |
| SMILES | C(C(C(=O)O)S)C(=O)O |
| Synonym | mercaptosuccinic acid,thiomalic acid,2-thiomalic acid,2-mercaptosuccinic acid,monomercaptosuccinic acid,butanedioic acid, mercapto,malic acid, 2-thio,mercaptosuccinate,2-sulfanylsuccinic acid,dl-mercaptosuccinic acid |
| IUPAC Name | 2-sulfanylbutanedioic acid |
| InChI Key | NJRXVEJTAYWCQJ-UHFFFAOYSA-N |
| Molecular Formula | C4H6O4S |
Mercury(II) trifluoromethanesulfonate, 98%
CAS: 49540-00-3 Molecular Formula: C2F6HgO6S2 Molecular Weight (g/mol): 498.718 MDL Number: MFCD00144746 InChI Key: BPVYMDMPLCOQPJ-UHFFFAOYSA-L Synonym: mercury ii trifluoromethanesulfonate,mercury triflate,mercury 2+ ditriflate,hg otf 2,ksc491a8p,mercury ii trifluoromethanesulphonate,mercury 2+ ; trifluoromethanesulfonate,mercury 2+ ion ditrifluoromethanesulfonate,mercury ii trifluoromethanesulfonate trace metals basis PubChem CID: 2775250 IUPAC Name: mercury(2+);trifluoromethanesulfonate SMILES: C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].[Hg+2]
| PubChem CID | 2775250 |
|---|---|
| CAS | 49540-00-3 |
| Molecular Weight (g/mol) | 498.718 |
| MDL Number | MFCD00144746 |
| SMILES | C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].[Hg+2] |
| Synonym | mercury ii trifluoromethanesulfonate,mercury triflate,mercury 2+ ditriflate,hg otf 2,ksc491a8p,mercury ii trifluoromethanesulphonate,mercury 2+ ; trifluoromethanesulfonate,mercury 2+ ion ditrifluoromethanesulfonate,mercury ii trifluoromethanesulfonate trace metals basis |
| IUPAC Name | mercury(2+);trifluoromethanesulfonate |
| InChI Key | BPVYMDMPLCOQPJ-UHFFFAOYSA-L |
| Molecular Formula | C2F6HgO6S2 |
Lithium isobutyrate, 98+%
CAS: 25179-23-1 Molecular Formula: C4H7LiO2 Molecular Weight (g/mol): 94.038 MDL Number: MFCD00210622 InChI Key: IIDVGIFOWJJSIJ-UHFFFAOYSA-M Synonym: lithium isobutyrate,lithium 2-methylpropanoate,acmc-1ccd2,isobutyric acid lithium salt,lithium 1+ isobutyrate,lithium 1+ ion isobutyrate PubChem CID: 23665557 IUPAC Name: lithium;2-methylpropanoate SMILES: [Li+].CC(C)C(=O)[O-]
| PubChem CID | 23665557 |
|---|---|
| CAS | 25179-23-1 |
| Molecular Weight (g/mol) | 94.038 |
| MDL Number | MFCD00210622 |
| SMILES | [Li+].CC(C)C(=O)[O-] |
| Synonym | lithium isobutyrate,lithium 2-methylpropanoate,acmc-1ccd2,isobutyric acid lithium salt,lithium 1+ isobutyrate,lithium 1+ ion isobutyrate |
| IUPAC Name | lithium;2-methylpropanoate |
| InChI Key | IIDVGIFOWJJSIJ-UHFFFAOYSA-M |
| Molecular Formula | C4H7LiO2 |
Ethyl 2-amino-4-phenylthiophene-3-carboxylate, 96%
CAS: 4815-36-5 Molecular Formula: C13H13NO2S Molecular Weight (g/mol): 247.312 MDL Number: MFCD00126391 InChI Key: WYTHTMKMOSPACP-UHFFFAOYSA-N Synonym: 2-amino-4-phenyl-thiophene-3-carboxylic acid ethyl ester,2-amino-4-phenylthiophene-3-carboxylic acid ethyl ester,ethyl 2-amino-4-phenyl-3-thiophenecarboxylate,thiophene-3-carboxylic acid, 2-amino-4-phenyl-, ethyl ester,amino-2 ethoxycarbonyl-3 phenyl-4 thiophene french,3-thiophenecarboxylic acid, 2-amino-4-phenyl-, ethyl ester,ethyl 2-amino-4-phenyl-thiophene-3-carboxylate,2-amino-4-phenyl-3-thiophenecarboxylic acid ethyl ester,cbmicro_024541,enamine_004212 PubChem CID: 73242 IUPAC Name: ethyl 2-amino-4-phenylthiophene-3-carboxylate SMILES: CCOC(=O)C1=C(SC=C1C2=CC=CC=C2)N
| PubChem CID | 73242 |
|---|---|
| CAS | 4815-36-5 |
| Molecular Weight (g/mol) | 247.312 |
| MDL Number | MFCD00126391 |
| SMILES | CCOC(=O)C1=C(SC=C1C2=CC=CC=C2)N |
| Synonym | 2-amino-4-phenyl-thiophene-3-carboxylic acid ethyl ester,2-amino-4-phenylthiophene-3-carboxylic acid ethyl ester,ethyl 2-amino-4-phenyl-3-thiophenecarboxylate,thiophene-3-carboxylic acid, 2-amino-4-phenyl-, ethyl ester,amino-2 ethoxycarbonyl-3 phenyl-4 thiophene french,3-thiophenecarboxylic acid, 2-amino-4-phenyl-, ethyl ester,ethyl 2-amino-4-phenyl-thiophene-3-carboxylate,2-amino-4-phenyl-3-thiophenecarboxylic acid ethyl ester,cbmicro_024541,enamine_004212 |
| IUPAC Name | ethyl 2-amino-4-phenylthiophene-3-carboxylate |
| InChI Key | WYTHTMKMOSPACP-UHFFFAOYSA-N |
| Molecular Formula | C13H13NO2S |
| CAS | 5785-06-8 |
|---|---|
| MDL Number | MFCD00007601 |
Pentane-1-sulfonic acid sodium salt, LiChropur™ EMD-Millipore
CAS: 22767-49-3 Molecular Formula: C5H11NaO3S Molecular Weight (g/mol): 174.19 MDL Number: MFCD00007541,MFCD00149548 InChI Key: ROBLTDOHDSGGDT-UHFFFAOYSA-M Synonym: sodium 1-pentanesulfonate,sodium pentane-1-sulfonate,sodium pentanesulfonate,1-pentanesulfonic acid sodium salt,1-pentanesulfonic acid, sodium salt,1-pentylsodiumsulfonate,ipc-alks-5,1-pentanesulfonate, sodium,pentanesulfonic acid na-salt,pentanesulfonic acidsodiumsalt PubChem CID: 23664617 IUPAC Name: sodium pentane-1-sulfonate SMILES: [Na+].CCCCCS([O-])(=O)=O
| PubChem CID | 23664617 |
|---|---|
| CAS | 22767-49-3 |
| Molecular Weight (g/mol) | 174.19 |
| MDL Number | MFCD00007541,MFCD00149548 |
| SMILES | [Na+].CCCCCS([O-])(=O)=O |
| Synonym | sodium 1-pentanesulfonate,sodium pentane-1-sulfonate,sodium pentanesulfonate,1-pentanesulfonic acid sodium salt,1-pentanesulfonic acid, sodium salt,1-pentylsodiumsulfonate,ipc-alks-5,1-pentanesulfonate, sodium,pentanesulfonic acid na-salt,pentanesulfonic acidsodiumsalt |
| IUPAC Name | sodium pentane-1-sulfonate |
| InChI Key | ROBLTDOHDSGGDT-UHFFFAOYSA-M |
| Molecular Formula | C5H11NaO3S |
4-Aminobenzeneboronic acid hydrochloride, 97%
CAS: 80460-73-7 Molecular Formula: C6H9BClNO2 Molecular Weight (g/mol): 173.403 MDL Number: MFCD03001333 InChI Key: QBYGJJSFMOVYOA-UHFFFAOYSA-N Synonym: 4-aminophenylboronic acid hydrochloride,4-aminophenyl boronic acid hydrochloride,4-aminobenzeneboronic acid hydrochloride,4-aminophenylboronic acid hcl,4-boronoaniline hydrochloride,4-aminophenylboronic acid, hcl,boronic acid, 4-aminophenyl-, hydrochloride,pubchem1747,4-aminophenylboronicacidhydrochloride,ksc494e4p PubChem CID: 2734614 IUPAC Name: (4-aminophenyl)boronic acid;hydrochloride SMILES: B(C1=CC=C(C=C1)N)(O)O.Cl
| PubChem CID | 2734614 |
|---|---|
| CAS | 80460-73-7 |
| Molecular Weight (g/mol) | 173.403 |
| MDL Number | MFCD03001333 |
| SMILES | B(C1=CC=C(C=C1)N)(O)O.Cl |
| Synonym | 4-aminophenylboronic acid hydrochloride,4-aminophenyl boronic acid hydrochloride,4-aminobenzeneboronic acid hydrochloride,4-aminophenylboronic acid hcl,4-boronoaniline hydrochloride,4-aminophenylboronic acid, hcl,boronic acid, 4-aminophenyl-, hydrochloride,pubchem1747,4-aminophenylboronicacidhydrochloride,ksc494e4p |
| IUPAC Name | (4-aminophenyl)boronic acid;hydrochloride |
| InChI Key | QBYGJJSFMOVYOA-UHFFFAOYSA-N |
| Molecular Formula | C6H9BClNO2 |